About 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid
9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid (PubChem CID 87313884) has the molecular formula C18H15NO7S
and a molecular weight of 389.39 g/mol. Its IUPAC name is 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid.
Molecular Properties
| Compound Name | 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid |
| PubChem CID | 87313884 |
| Molecular Formula | C18H15NO7S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid |
| SMILES | O=C1CC(OCC2c3ccccc3-c3ccc(S(=O)(=O)O)cc32)C(=O)N1O |
| InChI | InChI=1S/C18H15NO7S/c20-17-8-16(18(21)19(17)22)26-9-15-12-4-2-1-3-11(12)13-6-5-10(7-14(13)15)27(23,24)25/h1-7,15-16,22H,8-9H2,(H,23,24,25) |
| InChIKey | PYFHOXLGORCSDT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid?
The IUPAC name of 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid (CID 87313884) is 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid.
What is the SMILES notation for 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid?
The canonical SMILES for 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid is O=C1CC(OCC2c3ccccc3-c3ccc(S(=O)(=O)O)cc32)C(=O)N1O.
What is the InChIKey of 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid?
The InChIKey is PYFHOXLGORCSDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO7S/c20-17-8-16(18(21)19(17)22)26-9-15-12-4-2-1-3-11(12)13-6-5-10(7-14(13)15)27(23,24)25/h1-7,15-16,22H,8-9H2,(H,23,24,25).
What are the key properties of 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid?
9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid has a molecular weight of 389.39 g/mol, XLogP of 1.58, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)oxymethyl]-9H-fluorene-2-sulfonic acid is sourced from PubChem (CID 87313884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).