About 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide
1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide (PubChem CID 87314855) has the molecular formula C7H11AlCl4N2
and a molecular weight of 291.97 g/mol. Its IUPAC name is 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide.
Molecular Properties
| Compound Name | 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide |
| PubChem CID | 87314855 |
| Molecular Formula | C7H11AlCl4N2 |
| Molecular Weight | 291.97 g/mol |
| Exact Mass | 289.95 |
| IUPAC Name | 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide |
| SMILES | C=CCn1cc[n+](C)c1.Cl[Al-](Cl)(Cl)Cl |
| InChI | InChI=1S/C7H11N2.Al.4ClH/c1-3-4-9-6-5-8(2)7-9;;;;;/h3,5-7H,1,4H2,2H3;;4*1H/q+1;+3;;;;/p-4 |
| InChIKey | OAGULQIGWRTEQE-UHFFFAOYSA-J |
| XLogP | 2.88 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.97 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide?
The IUPAC name of 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide (CID 87314855) is 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide.
What is the SMILES notation for 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide?
The canonical SMILES for 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide is C=CCn1cc[n+](C)c1.Cl[Al-](Cl)(Cl)Cl.
What is the InChIKey of 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide?
The InChIKey is OAGULQIGWRTEQE-UHFFFAOYSA-J. The full InChI is InChI=1S/C7H11N2.Al.4ClH/c1-3-4-9-6-5-8(2)7-9;;;;;/h3,5-7H,1,4H2,2H3;;4*1H/q+1;+3;;;;/p-4.
What are the key properties of 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide?
1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide has a molecular weight of 291.97 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroalumanuide is sourced from PubChem (CID 87314855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).