About 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide
1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide (PubChem CID 175102109) has the molecular formula C7H11BCl4N2
and a molecular weight of 275.80 g/mol. Its IUPAC name is 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide.
Molecular Properties
| Compound Name | 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide |
| PubChem CID | 175102109 |
| Molecular Formula | C7H11BCl4N2 |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide |
| SMILES | C=CCn1cc[n+](C)c1.Cl[B-](Cl)(Cl)Cl |
| InChI | InChI=1S/C7H11N2.BCl4/c1-3-4-9-6-5-8(2)7-9;2-1(3,4)5/h3,5-7H,1,4H2,2H3;/q+1;-1 |
| InChIKey | YWVRPNRIZCGJPZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide?
The IUPAC name of 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide (CID 175102109) is 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide.
What is the SMILES notation for 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide?
The canonical SMILES for 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide is C=CCn1cc[n+](C)c1.Cl[B-](Cl)(Cl)Cl.
What is the InChIKey of 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide?
The InChIKey is YWVRPNRIZCGJPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N2.BCl4/c1-3-4-9-6-5-8(2)7-9;2-1(3,4)5/h3,5-7H,1,4H2,2H3;/q+1;-1.
What are the key properties of 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide?
1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide has a molecular weight of 275.80 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-prop-2-enylimidazol-1-ium;tetrachloroboranuide is sourced from PubChem (CID 175102109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).