C12H22N2O3 — CID 87319476
tert-butyl N-[1-oxo-1-(prop-2-enylamino)butan-2-yl]carbamate (PubChem CID 87319476) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl N-[1-oxo-1-(prop-2-enylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-oxo-1-(prop-2-enylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 87319476 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | tert-butyl N-[1-oxo-1-(prop-2-enylamino)butan-2-yl]carbamate |
| SMILES | C=CCNC(=O)C(CC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O3/c1-6-8-13-10(15)9(7-2)14-11(16)17-12(3,4)5/h6,9H,1,7-8H2,2-5H3,(H,13,15)(H,14,16) |
| InChIKey | XBPZXNADNYZOQM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|