C22H19F3N4O2 — CID 87325432
[1'-[2-[2-(trifluoromethyl)phenoxy]acetyl]spiro[indole-3,4'-piperidine]-2-yl]cyanamide (PubChem CID 87325432) has the molecular formula C22H19F3N4O2 and a molecular weight of 428.41 g/mol. Its IUPAC name is [1'-[2-[2-(trifluoromethyl)phenoxy]acetyl]spiro[indole-3,4'-piperidine]-2-yl]cyanamide.
| Compound Name | [1'-[2-[2-(trifluoromethyl)phenoxy]acetyl]spiro[indole-3,4'-piperidine]-2-yl]cyanamide |
|---|---|
| PubChem CID | 87325432 |
| Molecular Formula | C22H19F3N4O2 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [1'-[2-[2-(trifluoromethyl)phenoxy]acetyl]spiro[indole-3,4'-piperidine]-2-yl]cyanamide |
| SMILES | N#CNC1=Nc2ccccc2C12CCN(C(=O)COc1ccccc1C(F)(F)F)CC2 |
| InChI | InChI=1S/C22H19F3N4O2/c23-22(24,25)16-6-2-4-8-18(16)31-13-19(30)29-11-9-21(10-12-29)15-5-1-3-7-17(15)28-20(21)27-14-26/h1-8H,9-13H2,(H,27,28) |
| InChIKey | WNINAAALLLOHHL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 77.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|