C26H55N3O5 — CID 87330728
2-(dimethylamino)pentanoic acid;tetradecanamide;2-(trimethylazaniumyl)acetate (PubChem CID 87330728) has the molecular formula C26H55N3O5 and a molecular weight of 489.74 g/mol. Its IUPAC name is 2-(dimethylamino)pentanoic acid;tetradecanamide;2-(trimethylazaniumyl)acetate.
| Compound Name | 2-(dimethylamino)pentanoic acid;tetradecanamide;2-(trimethylazaniumyl)acetate |
|---|---|
| PubChem CID | 87330728 |
| Molecular Formula | C26H55N3O5 |
| Molecular Weight | 489.74 g/mol |
| Exact Mass | 489.41 |
| IUPAC Name | 2-(dimethylamino)pentanoic acid;tetradecanamide;2-(trimethylazaniumyl)acetate |
| SMILES | CCCC(C(=O)O)N(C)C.CCCCCCCCCCCCCC(N)=O.C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C14H29NO.C7H15NO2.C5H11NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-4-5-6(7(9)10)8(2)3;1-6(2,3)4-5(7)8/h2-13H2,1H3,(H2,15,16);6H,4-5H2,1-3H3,(H,9,10);4H2,1-3H3 |
| InChIKey | LALQUIUFOCEFLQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.74 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|