About 2-hydroxyacetyl chloride;octadecanoic acid
2-hydroxyacetyl chloride;octadecanoic acid (PubChem CID 87337704) has the molecular formula C20H39ClO4
and a molecular weight of 378.98 g/mol. Its IUPAC name is 2-hydroxyacetyl chloride;octadecanoic acid.
Molecular Properties
| Compound Name | 2-hydroxyacetyl chloride;octadecanoic acid |
| PubChem CID | 87337704 |
| Molecular Formula | C20H39ClO4 |
| Molecular Weight | 378.98 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 2-hydroxyacetyl chloride;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.O=C(Cl)CO |
| InChI | InChI=1S/C18H36O2.C2H3ClO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3-2(5)1-4/h2-17H2,1H3,(H,19,20);4H,1H2 |
| InChIKey | LGMOJESSFAMREW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.98 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyacetyl chloride;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyacetyl chloride;octadecanoic acid?
The IUPAC name of 2-hydroxyacetyl chloride;octadecanoic acid (CID 87337704) is 2-hydroxyacetyl chloride;octadecanoic acid.
What is the SMILES notation for 2-hydroxyacetyl chloride;octadecanoic acid?
The canonical SMILES for 2-hydroxyacetyl chloride;octadecanoic acid is CCCCCCCCCCCCCCCCCC(=O)O.O=C(Cl)CO.
What is the InChIKey of 2-hydroxyacetyl chloride;octadecanoic acid?
The InChIKey is LGMOJESSFAMREW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C2H3ClO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3-2(5)1-4/h2-17H2,1H3,(H,19,20);4H,1H2.
What are the key properties of 2-hydroxyacetyl chloride;octadecanoic acid?
2-hydroxyacetyl chloride;octadecanoic acid has a molecular weight of 378.98 g/mol, XLogP of 6.08, 17 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyacetyl chloride;octadecanoic acid is sourced from PubChem (CID 87337704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).