C12H13F3NO5S+ — CID 87338293
3-(trifluoromethylsulfonyloxy)-1,2,4,5-tetrahydro-3-benzazepin-3-ium-3-carboxylic acid (PubChem CID 87338293) has the molecular formula C12H13F3NO5S+ and a molecular weight of 340.30 g/mol. Its IUPAC name is 3-(trifluoromethylsulfonyloxy)-1,2,4,5-tetrahydro-3-benzazepin-3-ium-3-carboxylic acid.
| Compound Name | 3-(trifluoromethylsulfonyloxy)-1,2,4,5-tetrahydro-3-benzazepin-3-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 87338293 |
| Molecular Formula | C12H13F3NO5S+ |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 3-(trifluoromethylsulfonyloxy)-1,2,4,5-tetrahydro-3-benzazepin-3-ium-3-carboxylic acid |
| SMILES | O=C(O)[N+]1(OS(=O)(=O)C(F)(F)F)CCc2ccccc2CC1 |
| InChI | InChI=1S/C12H12F3NO5S/c13-12(14,15)22(19,20)21-16(11(17)18)7-5-9-3-1-2-4-10(9)6-8-16/h1-4H,5-8H2/p+1 |
| InChIKey | GYESIMVSBKWHDL-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|