About ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate
ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate (PubChem CID 87340294) has the molecular formula C13H24F2O2S
and a molecular weight of 282.40 g/mol. Its IUPAC name is ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate.
Molecular Properties
| Compound Name | ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate |
| PubChem CID | 87340294 |
| Molecular Formula | C13H24F2O2S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate |
| SMILES | CCOC(=O)C(SCCCC(F)(F)CC)C(C)C |
| InChI | InChI=1S/C13H24F2O2S/c1-5-13(14,15)8-7-9-18-11(10(3)4)12(16)17-6-2/h10-11H,5-9H2,1-4H3 |
| InChIKey | UAGUVNRQEWGZSV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate?
The IUPAC name of ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate (CID 87340294) is ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate.
What is the SMILES notation for ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate?
The canonical SMILES for ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate is CCOC(=O)C(SCCCC(F)(F)CC)C(C)C.
What is the InChIKey of ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate?
The InChIKey is UAGUVNRQEWGZSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24F2O2S/c1-5-13(14,15)8-7-9-18-11(10(3)4)12(16)17-6-2/h10-11H,5-9H2,1-4H3.
What are the key properties of ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate?
ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate has a molecular weight of 282.40 g/mol, XLogP of 4.13, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate is sourced from PubChem (CID 87340294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).