C13H24F2O2S — CID 87340294
ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate (PubChem CID 87340294) has the molecular formula C13H24F2O2S and a molecular weight of 282.40 g/mol. Its IUPAC name is ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate.
| Compound Name | ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 87340294 |
| Molecular Formula | C13H24F2O2S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | ethyl 2-(4,4-difluorohexylsulfanyl)-3-methylbutanoate |
| SMILES | CCOC(=O)C(SCCCC(F)(F)CC)C(C)C |
| InChI | InChI=1S/C13H24F2O2S/c1-5-13(14,15)8-7-9-18-11(10(3)4)12(16)17-6-2/h10-11H,5-9H2,1-4H3 |
| InChIKey | UAGUVNRQEWGZSV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|