About methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate
methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate (PubChem CID 87340658) has the molecular formula C9H16F2O2S
and a molecular weight of 226.29 g/mol. Its IUPAC name is methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate.
Molecular Properties
| Compound Name | methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate |
| PubChem CID | 87340658 |
| Molecular Formula | C9H16F2O2S |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate |
| SMILES | COC(=O)C(SCCC(F)F)C(C)C |
| InChI | InChI=1S/C9H16F2O2S/c1-6(2)8(9(12)13-3)14-5-4-7(10)11/h6-8H,4-5H2,1-3H3 |
| InChIKey | CMCIPVTWDRQJIG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate?
The IUPAC name of methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate (CID 87340658) is methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate.
What is the SMILES notation for methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate?
The canonical SMILES for methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate is COC(=O)C(SCCC(F)F)C(C)C.
What is the InChIKey of methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate?
The InChIKey is CMCIPVTWDRQJIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2O2S/c1-6(2)8(9(12)13-3)14-5-4-7(10)11/h6-8H,4-5H2,1-3H3.
What are the key properties of methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate?
methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate has a molecular weight of 226.29 g/mol, XLogP of 2.57, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate is sourced from PubChem (CID 87340658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).