C24H20Cl2F4N2O3 — CID 87344672
(2,2,2-trifluoroacetyl) (2R,3S,4R,5S)-5-tert-butyl-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyanopyrrolidine-2-carboxylate (PubChem CID 87344672) has the molecular formula C24H20Cl2F4N2O3 and a molecular weight of 531.33 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2R,3S,4R,5S)-5-tert-butyl-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyanopyrrolidine-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) (2R,3S,4R,5S)-5-tert-butyl-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyanopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 87344672 |
| Molecular Formula | C24H20Cl2F4N2O3 |
| Molecular Weight | 531.33 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2R,3S,4R,5S)-5-tert-butyl-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyanopyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)[C@@H]1N[C@@H](C(=O)OC(=O)C(F)(F)F)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20Cl2F4N2O3/c1-22(2,3)20-23(11-31,12-7-9-13(25)10-8-12)16(14-5-4-6-15(26)17(14)27)18(32-20)19(33)35-21(34)24(28,29)30/h4-10,16,18,20,32H,1-3H3/t16-,18+,20-,23+/m0/s1 |
| InChIKey | XYDIGRCHJIMPTI-KZHMMYNISA-N |
| XLogP | 5.70 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.33 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|