C24H34N4O6 — CID 87348583
(2R)-2-[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl]-2-(hydroxymethyl)pyrrolidine-1-carboxylic acid (PubChem CID 87348583) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is (2R)-2-[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl]-2-(hydroxymethyl)pyrrolidine-1-carboxylic acid.
| Compound Name | (2R)-2-[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl]-2-(hydroxymethyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87348583 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | (2R)-2-[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl]-2-(hydroxymethyl)pyrrolidine-1-carboxylic acid |
| SMILES | O=C(NO)[C@H]1C[C@H]([C@@]2(CO)CCCN2C(=O)O)CC[C@@H]1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H34N4O6/c29-16-24(9-4-10-28(24)23(32)33)17-7-8-19(20(15-17)21(30)25-34)22(31)27-13-11-26(12-14-27)18-5-2-1-3-6-18/h1-3,5-6,17,19-20,29,34H,4,7-16H2,(H,25,30)(H,32,33)/t17-,19+,20+,24+/m1/s1 |
| InChIKey | KFYQYNBXFZAMGI-QHYAIYAISA-N |
| XLogP | 1.38 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|