C25H31N5O6 — CID 87348934
(2S,3S,5S)-3-(hydroxycarbamoyl)-2-methyl-5-[(6-methyl-2-pyridinyl)oxy]-2-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylic acid (PubChem CID 87348934) has the molecular formula C25H31N5O6 and a molecular weight of 497.55 g/mol. Its IUPAC name is (2S,3S,5S)-3-(hydroxycarbamoyl)-2-methyl-5-[(6-methyl-2-pyridinyl)oxy]-2-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylic acid.
| Compound Name | (2S,3S,5S)-3-(hydroxycarbamoyl)-2-methyl-5-[(6-methyl-2-pyridinyl)oxy]-2-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87348934 |
| Molecular Formula | C25H31N5O6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | (2S,3S,5S)-3-(hydroxycarbamoyl)-2-methyl-5-[(6-methyl-2-pyridinyl)oxy]-2-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylic acid |
| SMILES | Cc1cccc(O[C@H]2C[C@H](C(=O)NO)[C@@](C)(C(=O)N3CCN(c4ccccc4)CC3)N(C(=O)O)C2)n1 |
| InChI | InChI=1S/C25H31N5O6/c1-17-7-6-10-21(26-17)36-19-15-20(22(31)27-35)25(2,30(16-19)24(33)34)23(32)29-13-11-28(12-14-29)18-8-4-3-5-9-18/h3-10,19-20,35H,11-16H2,1-2H3,(H,27,31)(H,33,34)/t19-,20+,25-/m0/s1 |
| InChIKey | BGUJCJNTLZCYKI-DFIYOIEZSA-N |
| XLogP | 1.75 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|