C24H34N4O6 — CID 87530050
cyclohexyl (3S,4S)-4-hydroxy-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylate (PubChem CID 87530050) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is cyclohexyl (3S,4S)-4-hydroxy-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylate.
| Compound Name | cyclohexyl (3S,4S)-4-hydroxy-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87530050 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | cyclohexyl (3S,4S)-4-hydroxy-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylate |
| SMILES | O=C(NO)[C@H]1CN(C(=O)OC2CCCCC2)CC[C@@]1(O)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H34N4O6/c29-21(25-33)20-17-28(23(31)34-19-9-5-2-6-10-19)12-11-24(20,32)22(30)27-15-13-26(14-16-27)18-7-3-1-4-8-18/h1,3-4,7-8,19-20,32-33H,2,5-6,9-17H2,(H,25,29)/t20-,24+/m1/s1 |
| InChIKey | QAFMJGWWIYGLGS-YKSBVNFPSA-N |
| XLogP | 1.36 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|