C17H30N2O5 — CID 87349654
N-ethenyl-N-[11-[ethenyl(formyl)amino]-3,6,9-trihydroxyundecyl]formamide (PubChem CID 87349654) has the molecular formula C17H30N2O5 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-ethenyl-N-[11-[ethenyl(formyl)amino]-3,6,9-trihydroxyundecyl]formamide.
| Compound Name | N-ethenyl-N-[11-[ethenyl(formyl)amino]-3,6,9-trihydroxyundecyl]formamide |
|---|---|
| PubChem CID | 87349654 |
| Molecular Formula | C17H30N2O5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | N-ethenyl-N-[11-[ethenyl(formyl)amino]-3,6,9-trihydroxyundecyl]formamide |
| SMILES | C=CN(C=O)CCC(O)CCC(O)CCC(O)CCN(C=C)C=O |
| InChI | InChI=1S/C17H30N2O5/c1-3-18(13-20)11-9-16(23)7-5-15(22)6-8-17(24)10-12-19(4-2)14-21/h3-4,13-17,22-24H,1-2,5-12H2 |
| InChIKey | CKHZSKJPDUVUPI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|