C13H25NO — CID 155348936
N-(4,6-dimethyloctyl)-N-ethenylformamide (PubChem CID 155348936) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is N-(4,6-dimethyloctyl)-N-ethenylformamide.
| Compound Name | N-(4,6-dimethyloctyl)-N-ethenylformamide |
|---|---|
| PubChem CID | 155348936 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N-(4,6-dimethyloctyl)-N-ethenylformamide |
| SMILES | C=CN(C=O)CCCC(C)CC(C)CC |
| InChI | InChI=1S/C13H25NO/c1-5-12(3)10-13(4)8-7-9-14(6-2)11-15/h6,11-13H,2,5,7-10H2,1,3-4H3 |
| InChIKey | MCISCFXMKKQXSY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|