C22H24N6O7 — CID 87350237
4-N-[[4-(3-hydroxypropyl)phenyl]methyl]benzene-1,2,3,4,5,6-hexacarboxamide (PubChem CID 87350237) has the molecular formula C22H24N6O7 and a molecular weight of 484.47 g/mol. Its IUPAC name is 4-N-[[4-(3-hydroxypropyl)phenyl]methyl]benzene-1,2,3,4,5,6-hexacarboxamide.
| Compound Name | 4-N-[[4-(3-hydroxypropyl)phenyl]methyl]benzene-1,2,3,4,5,6-hexacarboxamide |
|---|---|
| PubChem CID | 87350237 |
| Molecular Formula | C22H24N6O7 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 4-N-[[4-(3-hydroxypropyl)phenyl]methyl]benzene-1,2,3,4,5,6-hexacarboxamide |
| SMILES | NC(=O)c1c(C(N)=O)c(C(N)=O)c(C(=O)NCc2ccc(CCCO)cc2)c(C(N)=O)c1C(N)=O |
| InChI | InChI=1S/C22H24N6O7/c23-17(30)11-12(18(24)31)14(20(26)33)16(15(21(27)34)13(11)19(25)32)22(35)28-8-10-5-3-9(4-6-10)2-1-7-29/h3-6,29H,1-2,7-8H2,(H2,23,30)(H2,24,31)(H2,25,32)(H2,26,33)(H2,27,34)(H,28,35) |
| InChIKey | VVMQSSIIXJVUII-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 264.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |