C22H24N6O12 — CID 87352787
(3,4-dinitrophenyl)methyl N-(6-aminohexyl)-N-[(3,4-dinitrophenyl)methoxycarbonyl]carbamate (PubChem CID 87352787) has the molecular formula C22H24N6O12 and a molecular weight of 564.46 g/mol. Its IUPAC name is (3,4-dinitrophenyl)methyl N-(6-aminohexyl)-N-[(3,4-dinitrophenyl)methoxycarbonyl]carbamate.
| Compound Name | (3,4-dinitrophenyl)methyl N-(6-aminohexyl)-N-[(3,4-dinitrophenyl)methoxycarbonyl]carbamate |
|---|---|
| PubChem CID | 87352787 |
| Molecular Formula | C22H24N6O12 |
| Molecular Weight | 564.46 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | (3,4-dinitrophenyl)methyl N-(6-aminohexyl)-N-[(3,4-dinitrophenyl)methoxycarbonyl]carbamate |
| SMILES | NCCCCCCN(C(=O)OCc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1)C(=O)OCc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24N6O12/c23-9-3-1-2-4-10-24(21(29)39-13-15-5-7-17(25(31)32)19(11-15)27(35)36)22(30)40-14-16-6-8-18(26(33)34)20(12-16)28(37)38/h5-8,11-12H,1-4,9-10,13-14,23H2 |
| InChIKey | AAPJQWPTLGDKJY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 254.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|