C12H21NO4 — CID 87354353
2-(aminomethylidene)-3,3-dimethylbutanoic acid;methyl 2-methylprop-2-enoate (PubChem CID 87354353) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-(aminomethylidene)-3,3-dimethylbutanoic acid;methyl 2-methylprop-2-enoate.
| Compound Name | 2-(aminomethylidene)-3,3-dimethylbutanoic acid;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87354353 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 2-(aminomethylidene)-3,3-dimethylbutanoic acid;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.CC(C)(C)C(=CN)C(=O)O |
| InChI | InChI=1S/C7H13NO2.C5H8O2/c1-7(2,3)5(4-8)6(9)10;1-4(2)5(6)7-3/h4H,8H2,1-3H3,(H,9,10);1H2,2-3H3 |
| InChIKey | ZUCILZISAHNLFB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|