C44H37NO4S — CID 87356254
(2R)-2-(3-benzhydrylphenyl)-2-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-sulfanylpropanoic acid (PubChem CID 87356254) has the molecular formula C44H37NO4S and a molecular weight of 675.85 g/mol. Its IUPAC name is (2R)-2-(3-benzhydrylphenyl)-2-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-(3-benzhydrylphenyl)-2-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87356254 |
| Molecular Formula | C44H37NO4S |
| Molecular Weight | 675.85 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | (2R)-2-(3-benzhydrylphenyl)-2-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-sulfanylpropanoic acid |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N(Cc1ccccc1)[C@@](CS)(C(=O)O)c1cccc(C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C44H37NO4S/c46-42(47)44(30-50,35-22-14-21-34(27-35)41(32-17-6-2-7-18-32)33-19-8-3-9-20-33)45(28-31-15-4-1-5-16-31)43(48)49-29-40-38-25-12-10-23-36(38)37-24-11-13-26-39(37)40/h1-27,40-41,50H,28-30H2,(H,46,47)/t44-/m1/s1 |
| InChIKey | VMSSGOXGSCNHOO-USYZEHPZSA-N |
| XLogP | 9.53 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.85 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|