C39H35NO4S — CID 87356548
(2R)-2-(3-benzhydrylphenyl)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-sulfanylpropanoic acid (PubChem CID 87356548) has the molecular formula C39H35NO4S and a molecular weight of 613.78 g/mol. Its IUPAC name is (2R)-2-(3-benzhydrylphenyl)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-(3-benzhydrylphenyl)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87356548 |
| Molecular Formula | C39H35NO4S |
| Molecular Weight | 613.78 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | (2R)-2-(3-benzhydrylphenyl)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CCN(C(=O)OCC1c2ccccc2-c2ccccc21)[C@@](CS)(C(=O)O)c1cccc(C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C39H35NO4S/c1-2-40(38(43)44-25-35-33-22-11-9-20-31(33)32-21-10-12-23-34(32)35)39(26-45,37(41)42)30-19-13-18-29(24-30)36(27-14-5-3-6-15-27)28-16-7-4-8-17-28/h3-24,35-36,45H,2,25-26H2,1H3,(H,41,42)/t39-/m1/s1 |
| InChIKey | RHXSYUOSJBBFRW-LDLOPFEMSA-N |
| XLogP | 8.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.78 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|