C27H24N2O13 — CID 87357989
bis[(4-nitrophenyl)-(2-oxo-5-propyl-1,3-dioxol-4-yl)methyl] carbonate (PubChem CID 87357989) has the molecular formula C27H24N2O13 and a molecular weight of 584.49 g/mol. Its IUPAC name is bis[(4-nitrophenyl)-(2-oxo-5-propyl-1,3-dioxol-4-yl)methyl] carbonate.
| Compound Name | bis[(4-nitrophenyl)-(2-oxo-5-propyl-1,3-dioxol-4-yl)methyl] carbonate |
|---|---|
| PubChem CID | 87357989 |
| Molecular Formula | C27H24N2O13 |
| Molecular Weight | 584.49 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | bis[(4-nitrophenyl)-(2-oxo-5-propyl-1,3-dioxol-4-yl)methyl] carbonate |
| SMILES | CCCc1oc(=O)oc1C(OC(=O)OC(c1ccc([N+](=O)[O-])cc1)c1oc(=O)oc1CCC)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H24N2O13/c1-3-5-19-23(41-25(30)37-19)21(15-7-11-17(12-8-15)28(33)34)39-27(32)40-22(16-9-13-18(14-10-16)29(35)36)24-20(6-4-2)38-26(31)42-24/h7-14,21-22H,3-6H2,1-2H3 |
| InChIKey | IQMAIHKCICIRPN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 208.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|