C16H23N3O6S — CID 87362403
1-[(3-amino-3-oxoprop-1-en-2-yl)-prop-2-enoylamino]-3-(1-ethenyl-2-oxopyrrolidin-3-yl)-2-methylpropane-1-sulfonic acid (PubChem CID 87362403) has the molecular formula C16H23N3O6S and a molecular weight of 385.44 g/mol. Its IUPAC name is 1-[(3-amino-3-oxoprop-1-en-2-yl)-prop-2-enoylamino]-3-(1-ethenyl-2-oxopyrrolidin-3-yl)-2-methylpropane-1-sulfonic acid.
| Compound Name | 1-[(3-amino-3-oxoprop-1-en-2-yl)-prop-2-enoylamino]-3-(1-ethenyl-2-oxopyrrolidin-3-yl)-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 87362403 |
| Molecular Formula | C16H23N3O6S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 1-[(3-amino-3-oxoprop-1-en-2-yl)-prop-2-enoylamino]-3-(1-ethenyl-2-oxopyrrolidin-3-yl)-2-methylpropane-1-sulfonic acid |
| SMILES | C=CC(=O)N(C(=C)C(N)=O)C(C(C)CC1CCN(C=C)C1=O)S(=O)(=O)O |
| InChI | InChI=1S/C16H23N3O6S/c1-5-13(20)19(11(4)14(17)21)16(26(23,24)25)10(3)9-12-7-8-18(6-2)15(12)22/h5-6,10,12,16H,1-2,4,7-9H2,3H3,(H2,17,21)(H,23,24,25) |
| InChIKey | LGLPIAVRDAPVEE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|