C13H25N3O5S — CID 146418341
azane;1-ethenylpyrrolidin-2-one;1-[methyl(prop-2-enoyl)amino]propane-2-sulfonic acid (PubChem CID 146418341) has the molecular formula C13H25N3O5S and a molecular weight of 335.43 g/mol. Its IUPAC name is azane;1-ethenylpyrrolidin-2-one;1-[methyl(prop-2-enoyl)amino]propane-2-sulfonic acid.
| Compound Name | azane;1-ethenylpyrrolidin-2-one;1-[methyl(prop-2-enoyl)amino]propane-2-sulfonic acid |
|---|---|
| PubChem CID | 146418341 |
| Molecular Formula | C13H25N3O5S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | azane;1-ethenylpyrrolidin-2-one;1-[methyl(prop-2-enoyl)amino]propane-2-sulfonic acid |
| SMILES | C=CC(=O)N(C)CC(C)S(=O)(=O)O.C=CN1CCCC1=O.N |
| InChI | InChI=1S/C7H13NO4S.C6H9NO.H3N/c1-4-7(9)8(3)5-6(2)13(10,11)12;1-2-7-5-3-4-6(7)8;/h4,6H,1,5H2,2-3H3,(H,10,11,12);2H,1,3-5H2;1H3 |
| InChIKey | VTFMJDQJHBEAMV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 129.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|