About azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid
azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid (PubChem CID 170852379) has the molecular formula C13H25N3O5S
and a molecular weight of 335.43 g/mol. Its IUPAC name is azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid.
Molecular Properties
| Compound Name | azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
| PubChem CID | 170852379 |
| Molecular Formula | C13H25N3O5S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)O.C=CN1CCCC1=O.N |
| InChI | InChI=1S/C7H13NO4S.C6H9NO.H3N/c1-4-6(9)8-7(2,3)5-13(10,11)12;1-2-7-5-3-4-6(7)8;/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);2H,1,3-5H2;1H3 |
| InChIKey | ULLGHMIWHFSJGN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid?
The IUPAC name of azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid (CID 170852379) is azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid.
What is the SMILES notation for azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid?
The canonical SMILES for azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid is C=CC(=O)NC(C)(C)CS(=O)(=O)O.C=CN1CCCC1=O.N.
What is the InChIKey of azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid?
The InChIKey is ULLGHMIWHFSJGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4S.C6H9NO.H3N/c1-4-6(9)8-7(2,3)5-13(10,11)12;1-2-7-5-3-4-6(7)8;/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);2H,1,3-5H2;1H3.
What are the key properties of azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid?
azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid has a molecular weight of 335.43 g/mol, XLogP of 0.87, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-ethenylpyrrolidin-2-one;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid is sourced from PubChem (CID 170852379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).