C18H30N2O8S — CID 88766250
1-ethenylpyrrolidin-2-one;2-hydroxyethyl prop-2-enoate;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid (PubChem CID 88766250) has the molecular formula C18H30N2O8S and a molecular weight of 434.51 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;2-hydroxyethyl prop-2-enoate;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid.
| Compound Name | 1-ethenylpyrrolidin-2-one;2-hydroxyethyl prop-2-enoate;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88766250 |
| Molecular Formula | C18H30N2O8S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;2-hydroxyethyl prop-2-enoate;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)O.C=CC(=O)OCCO.C=CN1CCCC1=O |
| InChI | InChI=1S/C7H13NO4S.C6H9NO.C5H8O3/c1-4-6(9)8-7(2,3)5-13(10,11)12;1-2-7-5-3-4-6(7)8;1-2-5(7)8-4-3-6/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);2H,1,3-5H2;2,6H,1,3-4H2 |
| InChIKey | SSUSGTQCWWVSPL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|