C18H28N2O8S — CID 88766248
1-ethenylpyrrolidin-2-one;1-[[3-(2-hydroxyethoxycarbonyl)-2-methylidenebut-3-enoyl]amino]-2-methylpropane-1-sulfonic acid (PubChem CID 88766248) has the molecular formula C18H28N2O8S and a molecular weight of 432.50 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;1-[[3-(2-hydroxyethoxycarbonyl)-2-methylidenebut-3-enoyl]amino]-2-methylpropane-1-sulfonic acid.
| Compound Name | 1-ethenylpyrrolidin-2-one;1-[[3-(2-hydroxyethoxycarbonyl)-2-methylidenebut-3-enoyl]amino]-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 88766248 |
| Molecular Formula | C18H28N2O8S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;1-[[3-(2-hydroxyethoxycarbonyl)-2-methylidenebut-3-enoyl]amino]-2-methylpropane-1-sulfonic acid |
| SMILES | C=C(C(=C)C(=O)OCCO)C(=O)NC(C(C)C)S(=O)(=O)O.C=CN1CCCC1=O |
| InChI | InChI=1S/C12H19NO7S.C6H9NO/c1-7(2)11(21(17,18)19)13-10(15)8(3)9(4)12(16)20-6-5-14;1-2-7-5-3-4-6(7)8/h7,11,14H,3-6H2,1-2H3,(H,13,15)(H,17,18,19);2H,1,3-5H2 |
| InChIKey | OOYBQNQLGNFATJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|