C24H17F3N6O3S — CID 87366628
3,6-diamino-5-cyano-4-[4-methoxy-3-[(2,3,5-trifluoro-4-methylbenzoyl)amino]phenyl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 87366628) has the molecular formula C24H17F3N6O3S and a molecular weight of 526.50 g/mol. Its IUPAC name is 3,6-diamino-5-cyano-4-[4-methoxy-3-[(2,3,5-trifluoro-4-methylbenzoyl)amino]phenyl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3,6-diamino-5-cyano-4-[4-methoxy-3-[(2,3,5-trifluoro-4-methylbenzoyl)amino]phenyl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 87366628 |
| Molecular Formula | C24H17F3N6O3S |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 3,6-diamino-5-cyano-4-[4-methoxy-3-[(2,3,5-trifluoro-4-methylbenzoyl)amino]phenyl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COc1ccc(-c2c(C#N)c(N)nc3sc(C(N)=O)c(N)c23)cc1NC(=O)c1cc(F)c(C)c(F)c1F |
| InChI | InChI=1S/C24H17F3N6O3S/c1-8-12(25)6-10(18(27)17(8)26)23(35)32-13-5-9(3-4-14(13)36-2)15-11(7-28)21(30)33-24-16(15)19(29)20(37-24)22(31)34/h3-6H,29H2,1-2H3,(H2,30,33)(H2,31,34)(H,32,35) |
| InChIKey | FUPTWHVLBWWWEX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 170.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|