C16H20N2O6S — CID 8736776
[(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate (PubChem CID 8736776) has the molecular formula C16H20N2O6S and a molecular weight of 368.41 g/mol. Its IUPAC name is [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate.
| Compound Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
|---|---|
| PubChem CID | 8736776 |
| Molecular Formula | C16H20N2O6S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
| SMILES | C[C@@H](OC(=O)C[C@H]1CCS(=O)(=O)C1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O6S/c1-11(24-14(19)9-12-7-8-25(22,23)10-12)15(20)17-18-16(21)13-5-3-2-4-6-13/h2-6,11-12H,7-10H2,1H3,(H,17,20)(H,18,21)/t11-,12-/m1/s1 |
| InChIKey | YUGSYHPLIVFHEH-VXGBXAGGSA-N |
| XLogP | 0.20 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|