C16H28N2O9 — CID 87368026
(3S)-3-[[1-(2,2-dimethyl-3-nitrooxypropanoyl)oxyethoxy-formylamino]methyl]-5-methylhexanoic acid (PubChem CID 87368026) has the molecular formula C16H28N2O9 and a molecular weight of 392.41 g/mol. Its IUPAC name is (3S)-3-[[1-(2,2-dimethyl-3-nitrooxypropanoyl)oxyethoxy-formylamino]methyl]-5-methylhexanoic acid.
| Compound Name | (3S)-3-[[1-(2,2-dimethyl-3-nitrooxypropanoyl)oxyethoxy-formylamino]methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 87368026 |
| Molecular Formula | C16H28N2O9 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (3S)-3-[[1-(2,2-dimethyl-3-nitrooxypropanoyl)oxyethoxy-formylamino]methyl]-5-methylhexanoic acid |
| SMILES | CC(C)C[C@@H](CC(=O)O)CN(C=O)OC(C)OC(=O)C(C)(C)CO[N+](=O)[O-] |
| InChI | InChI=1S/C16H28N2O9/c1-11(2)6-13(7-14(20)21)8-17(10-19)27-12(3)26-15(22)16(4,5)9-25-18(23)24/h10-13H,6-9H2,1-5H3,(H,20,21)/t12?,13-/m0/s1 |
| InChIKey | BFCLMDKIJGTLBU-ABLWVSNPSA-N |
| XLogP | 1.64 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|