C74H60N2 — CID 87372229
3-N,8-N-bis[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]-3-N,8-N-bis(4-methylphenyl)fluoranthene-3,8-diamine (PubChem CID 87372229) has the molecular formula C74H60N2 and a molecular weight of 977.31 g/mol. Its IUPAC name is 3-N,8-N-bis[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]-3-N,8-N-bis(4-methylphenyl)fluoranthene-3,8-diamine.
| Compound Name | 3-N,8-N-bis[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]-3-N,8-N-bis(4-methylphenyl)fluoranthene-3,8-diamine |
|---|---|
| PubChem CID | 87372229 |
| Molecular Formula | C74H60N2 |
| Molecular Weight | 977.31 g/mol |
| Exact Mass | 976.48 |
| IUPAC Name | 3-N,8-N-bis[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]-3-N,8-N-bis(4-methylphenyl)fluoranthene-3,8-diamine |
| SMILES | Cc1ccc(C(=Cc2ccc(N(c3ccc(C)cc3)c3ccc4c(c3)-c3cccc5c(N(c6ccc(C)cc6)c6ccc(C=C(c7ccc(C)cc7)c7ccc(C)cc7)cc6)ccc-4c35)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C74H60N2/c1-49-10-26-57(27-11-49)70(58-28-12-50(2)13-29-58)46-55-22-38-62(39-23-55)75(61-34-18-53(5)19-35-61)65-42-43-66-68-44-45-73(69-9-7-8-67(74(68)69)72(66)48-65)76(63-36-20-54(6)21-37-63)64-40-24-56(25-41-64)47-71(59-30-14-51(3)15-31-59)60-32-16-52(4)17-33-60/h7-48H,1-6H3 |
| InChIKey | ZMUOBEWBBZBAGW-UHFFFAOYSA-N |
| XLogP | 20.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.31 |
| LogP ≤ 5 | 20.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|