C21H25NO3S — CID 87372952
methyl (2S)-2-[[4-oxo-4-(2-phenylphenyl)butyl]amino]-4-sulfanylbutanoate (PubChem CID 87372952) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is methyl (2S)-2-[[4-oxo-4-(2-phenylphenyl)butyl]amino]-4-sulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[4-oxo-4-(2-phenylphenyl)butyl]amino]-4-sulfanylbutanoate |
|---|---|
| PubChem CID | 87372952 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | methyl (2S)-2-[[4-oxo-4-(2-phenylphenyl)butyl]amino]-4-sulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCS)NCCCC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H25NO3S/c1-25-21(24)19(13-15-26)22-14-7-12-20(23)18-11-6-5-10-17(18)16-8-3-2-4-9-16/h2-6,8-11,19,22,26H,7,12-15H2,1H3/t19-/m0/s1 |
| InChIKey | JSECXFFWXJFLPW-IBGZPJMESA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|