C23H24N2O3S — CID 87372828
methyl 2-[[(2S)-1-(2-phenylbenzoyl)-2H-pyridin-2-yl]amino]-4-sulfanylbutanoate (PubChem CID 87372828) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is methyl 2-[[(2S)-1-(2-phenylbenzoyl)-2H-pyridin-2-yl]amino]-4-sulfanylbutanoate.
| Compound Name | methyl 2-[[(2S)-1-(2-phenylbenzoyl)-2H-pyridin-2-yl]amino]-4-sulfanylbutanoate |
|---|---|
| PubChem CID | 87372828 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | methyl 2-[[(2S)-1-(2-phenylbenzoyl)-2H-pyridin-2-yl]amino]-4-sulfanylbutanoate |
| SMILES | COC(=O)C(CCS)N[C@@H]1C=CC=CN1C(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H24N2O3S/c1-28-23(27)20(14-16-29)24-21-13-7-8-15-25(21)22(26)19-12-6-5-11-18(19)17-9-3-2-4-10-17/h2-13,15,20-21,24,29H,14,16H2,1H3/t20?,21-/m0/s1 |
| InChIKey | WVBYAIMFECXFKX-LBAQZLPGSA-N |
| XLogP | 3.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|