About methoxy(trimethyl)silane;trimethylsilylmethanol
methoxy(trimethyl)silane;trimethylsilylmethanol (PubChem CID 87378508) has the molecular formula C8H24O2Si2
and a molecular weight of 208.45 g/mol. Its IUPAC name is methoxy(trimethyl)silane;trimethylsilylmethanol.
Molecular Properties
| Compound Name | methoxy(trimethyl)silane;trimethylsilylmethanol |
| PubChem CID | 87378508 |
| Molecular Formula | C8H24O2Si2 |
| Molecular Weight | 208.45 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | methoxy(trimethyl)silane;trimethylsilylmethanol |
| SMILES | CO[Si](C)(C)C.C[Si](C)(C)CO |
| InChI | InChI=1S/2C4H12OSi/c1-6(2,3)4-5;1-5-6(2,3)4/h5H,4H2,1-3H3;1-4H3 |
| InChIKey | CHBUSKSPXZKCQR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methoxy(trimethyl)silane;trimethylsilylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy(trimethyl)silane;trimethylsilylmethanol?
The IUPAC name of methoxy(trimethyl)silane;trimethylsilylmethanol (CID 87378508) is methoxy(trimethyl)silane;trimethylsilylmethanol.
What is the SMILES notation for methoxy(trimethyl)silane;trimethylsilylmethanol?
The canonical SMILES for methoxy(trimethyl)silane;trimethylsilylmethanol is CO[Si](C)(C)C.C[Si](C)(C)CO.
What is the InChIKey of methoxy(trimethyl)silane;trimethylsilylmethanol?
The InChIKey is CHBUSKSPXZKCQR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H12OSi/c1-6(2,3)4-5;1-5-6(2,3)4/h5H,4H2,1-3H3;1-4H3.
What are the key properties of methoxy(trimethyl)silane;trimethylsilylmethanol?
methoxy(trimethyl)silane;trimethylsilylmethanol has a molecular weight of 208.45 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy(trimethyl)silane;trimethylsilylmethanol is sourced from PubChem (CID 87378508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).