C10H32O4Si4 — CID 123410849
dimethylsilane;[[dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methylsilyl]methanol (PubChem CID 123410849) has the molecular formula C10H32O4Si4 and a molecular weight of 328.71 g/mol. Its IUPAC name is dimethylsilane;[[dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methylsilyl]methanol.
| Compound Name | dimethylsilane;[[dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methylsilyl]methanol |
|---|---|
| PubChem CID | 123410849 |
| Molecular Formula | C10H32O4Si4 |
| Molecular Weight | 328.71 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | dimethylsilane;[[dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methylsilyl]methanol |
| SMILES | CO[Si](C)(CO)O[Si](C)(C)O[Si](C)(C)C.C[SiH2]C |
| InChI | InChI=1S/C8H24O4Si3.C2H8Si/c1-10-15(7,8-9)12-14(5,6)11-13(2,3)4;1-3-2/h9H,8H2,1-7H3;3H2,1-2H3 |
| InChIKey | OQUQOWXWQWPGGB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.71 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|