C8H26O3Si4 — CID 123516257
[dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methyl-methylsilylsilane (PubChem CID 123516257) has the molecular formula C8H26O3Si4 and a molecular weight of 282.64 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methyl-methylsilylsilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methyl-methylsilylsilane |
|---|---|
| PubChem CID | 123516257 |
| Molecular Formula | C8H26O3Si4 |
| Molecular Weight | 282.64 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methyl-methylsilylsilane |
| SMILES | CO[Si](C)(O[Si](C)(C)O[Si](C)(C)C)[SiH2]C |
| InChI | InChI=1S/C8H26O3Si4/c1-9-15(8,12-2)11-14(6,7)10-13(3,4)5/h12H2,1-8H3 |
| InChIKey | VELCCIDURUFONT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.64 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|