C10H12F4O3 — CID 87382689
ethyl 3,3,4,4-tetrafluoro-2-(2-methoxyethyl)cyclobutene-1-carboxylate (PubChem CID 87382689) has the molecular formula C10H12F4O3 and a molecular weight of 256.19 g/mol. Its IUPAC name is ethyl 3,3,4,4-tetrafluoro-2-(2-methoxyethyl)cyclobutene-1-carboxylate.
| Compound Name | ethyl 3,3,4,4-tetrafluoro-2-(2-methoxyethyl)cyclobutene-1-carboxylate |
|---|---|
| PubChem CID | 87382689 |
| Molecular Formula | C10H12F4O3 |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | ethyl 3,3,4,4-tetrafluoro-2-(2-methoxyethyl)cyclobutene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(CCOC)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H12F4O3/c1-3-17-8(15)7-6(4-5-16-2)9(11,12)10(7,13)14/h3-5H2,1-2H3 |
| InChIKey | WGOJARIXFICXFU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|