C11H10F8O3 — CID 25103639
propan-2-yl 3,3,4,4,5,5,6,6-octafluoro-2-methoxycyclohexene-1-carboxylate (PubChem CID 25103639) has the molecular formula C11H10F8O3 and a molecular weight of 342.18 g/mol. Its IUPAC name is propan-2-yl 3,3,4,4,5,5,6,6-octafluoro-2-methoxycyclohexene-1-carboxylate.
| Compound Name | propan-2-yl 3,3,4,4,5,5,6,6-octafluoro-2-methoxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 25103639 |
| Molecular Formula | C11H10F8O3 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | propan-2-yl 3,3,4,4,5,5,6,6-octafluoro-2-methoxycyclohexene-1-carboxylate |
| SMILES | COC1=C(C(=O)OC(C)C)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H10F8O3/c1-4(2)22-7(20)5-6(21-3)9(14,15)11(18,19)10(16,17)8(5,12)13/h4H,1-3H3 |
| InChIKey | GQZGUMMZUBIGQD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|