C18H16Cl2N3O4PS — CID 87382868
[[6-chloro-5-[4-chloro-3-(cyclopropylcarbamoyl)phenyl]-1H-benzimidazol-2-yl]-sulfanylmethyl]phosphonic acid (PubChem CID 87382868) has the molecular formula C18H16Cl2N3O4PS and a molecular weight of 472.29 g/mol. Its IUPAC name is [[6-chloro-5-[4-chloro-3-(cyclopropylcarbamoyl)phenyl]-1H-benzimidazol-2-yl]-sulfanylmethyl]phosphonic acid.
| Compound Name | [[6-chloro-5-[4-chloro-3-(cyclopropylcarbamoyl)phenyl]-1H-benzimidazol-2-yl]-sulfanylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 87382868 |
| Molecular Formula | C18H16Cl2N3O4PS |
| Molecular Weight | 472.29 g/mol |
| Exact Mass | 471.00 |
| IUPAC Name | [[6-chloro-5-[4-chloro-3-(cyclopropylcarbamoyl)phenyl]-1H-benzimidazol-2-yl]-sulfanylmethyl]phosphonic acid |
| SMILES | O=C(NC1CC1)c1cc(-c2cc3nc(C(S)P(=O)(O)O)[nH]c3cc2Cl)ccc1Cl |
| InChI | InChI=1S/C18H16Cl2N3O4PS/c19-12-4-1-8(5-11(12)17(24)21-9-2-3-9)10-6-14-15(7-13(10)20)23-16(22-14)18(29)28(25,26)27/h1,4-7,9,18,29H,2-3H2,(H,21,24)(H,22,23)(H2,25,26,27) |
| InChIKey | NAHQFWZNMWFJFZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|