C21H21Cl2N3OS — CID 67185383
N-[4-[amino(1,3-benzothiazol-2-yl)methyl]cyclohexyl]-2,5-dichlorobenzamide (PubChem CID 67185383) has the molecular formula C21H21Cl2N3OS and a molecular weight of 434.39 g/mol. Its IUPAC name is N-[4-[amino(1,3-benzothiazol-2-yl)methyl]cyclohexyl]-2,5-dichlorobenzamide.
| Compound Name | N-[4-[amino(1,3-benzothiazol-2-yl)methyl]cyclohexyl]-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 67185383 |
| Molecular Formula | C21H21Cl2N3OS |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | N-[4-[amino(1,3-benzothiazol-2-yl)methyl]cyclohexyl]-2,5-dichlorobenzamide |
| SMILES | NC(c1nc2ccccc2s1)C1CCC(NC(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C21H21Cl2N3OS/c22-13-7-10-16(23)15(11-13)20(27)25-14-8-5-12(6-9-14)19(24)21-26-17-3-1-2-4-18(17)28-21/h1-4,7,10-12,14,19H,5-6,8-9,24H2,(H,25,27) |
| InChIKey | XBIDLKQNPSPCBN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |