About 1-propoxyethyl tris(trimethylsilyl) silicate
1-propoxyethyl tris(trimethylsilyl) silicate (PubChem CID 87384146) has the molecular formula C14H38O5Si4
and a molecular weight of 398.80 g/mol. Its IUPAC name is 1-propoxyethyl tris(trimethylsilyl) silicate.
Molecular Properties
| Compound Name | 1-propoxyethyl tris(trimethylsilyl) silicate |
| PubChem CID | 87384146 |
| Molecular Formula | C14H38O5Si4 |
| Molecular Weight | 398.80 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-propoxyethyl tris(trimethylsilyl) silicate |
| SMILES | CCCOC(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H38O5Si4/c1-12-13-15-14(2)16-23(17-20(3,4)5,18-21(6,7)8)19-22(9,10)11/h14H,12-13H2,1-11H3 |
| InChIKey | OAMINVBLEGKSFM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.80 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-propoxyethyl tris(trimethylsilyl) silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propoxyethyl tris(trimethylsilyl) silicate?
The IUPAC name of 1-propoxyethyl tris(trimethylsilyl) silicate (CID 87384146) is 1-propoxyethyl tris(trimethylsilyl) silicate.
What is the SMILES notation for 1-propoxyethyl tris(trimethylsilyl) silicate?
The canonical SMILES for 1-propoxyethyl tris(trimethylsilyl) silicate is CCCOC(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of 1-propoxyethyl tris(trimethylsilyl) silicate?
The InChIKey is OAMINVBLEGKSFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H38O5Si4/c1-12-13-15-14(2)16-23(17-20(3,4)5,18-21(6,7)8)19-22(9,10)11/h14H,12-13H2,1-11H3.
What are the key properties of 1-propoxyethyl tris(trimethylsilyl) silicate?
1-propoxyethyl tris(trimethylsilyl) silicate has a molecular weight of 398.80 g/mol, XLogP of 4.77, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propoxyethyl tris(trimethylsilyl) silicate is sourced from PubChem (CID 87384146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).