C16H14ClN3O3 — CID 87387439
2-[5-(1,3-benzoxazol-2-ylamino)-6-chloro-2-pyridinyl]butanoic acid (PubChem CID 87387439) has the molecular formula C16H14ClN3O3 and a molecular weight of 331.76 g/mol. Its IUPAC name is 2-[5-(1,3-benzoxazol-2-ylamino)-6-chloro-2-pyridinyl]butanoic acid.
| Compound Name | 2-[5-(1,3-benzoxazol-2-ylamino)-6-chloro-2-pyridinyl]butanoic acid |
|---|---|
| PubChem CID | 87387439 |
| Molecular Formula | C16H14ClN3O3 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-[5-(1,3-benzoxazol-2-ylamino)-6-chloro-2-pyridinyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ccc(Nc2nc3ccccc3o2)c(Cl)n1 |
| InChI | InChI=1S/C16H14ClN3O3/c1-2-9(15(21)22)10-7-8-12(14(17)18-10)20-16-19-11-5-3-4-6-13(11)23-16/h3-9H,2H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | WXNYARWOEPDHFK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|