About (2-bromoacetyl)phosphonic acid;cyclohexanamine
(2-bromoacetyl)phosphonic acid;cyclohexanamine (PubChem CID 87391055) has the molecular formula C8H17BrNO4P
and a molecular weight of 302.11 g/mol. Its IUPAC name is (2-bromoacetyl)phosphonic acid;cyclohexanamine.
Molecular Properties
| Compound Name | (2-bromoacetyl)phosphonic acid;cyclohexanamine |
| PubChem CID | 87391055 |
| Molecular Formula | C8H17BrNO4P |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | (2-bromoacetyl)phosphonic acid;cyclohexanamine |
| SMILES | NC1CCCCC1.O=C(CBr)P(=O)(O)O |
| InChI | InChI=1S/C6H13N.C2H4BrO4P/c7-6-4-2-1-3-5-6;3-1-2(4)8(5,6)7/h6H,1-5,7H2;1H2,(H2,5,6,7) |
| InChIKey | BSWZATPMCHMPAI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-bromoacetyl)phosphonic acid;cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromoacetyl)phosphonic acid;cyclohexanamine?
The IUPAC name of (2-bromoacetyl)phosphonic acid;cyclohexanamine (CID 87391055) is (2-bromoacetyl)phosphonic acid;cyclohexanamine.
What is the SMILES notation for (2-bromoacetyl)phosphonic acid;cyclohexanamine?
The canonical SMILES for (2-bromoacetyl)phosphonic acid;cyclohexanamine is NC1CCCCC1.O=C(CBr)P(=O)(O)O.
What is the InChIKey of (2-bromoacetyl)phosphonic acid;cyclohexanamine?
The InChIKey is BSWZATPMCHMPAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C2H4BrO4P/c7-6-4-2-1-3-5-6;3-1-2(4)8(5,6)7/h6H,1-5,7H2;1H2,(H2,5,6,7).
What are the key properties of (2-bromoacetyl)phosphonic acid;cyclohexanamine?
(2-bromoacetyl)phosphonic acid;cyclohexanamine has a molecular weight of 302.11 g/mol, XLogP of 1.36, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromoacetyl)phosphonic acid;cyclohexanamine is sourced from PubChem (CID 87391055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).