C13H17BrO4 — CID 87391738
2-bromo-2-[4-(2,3-dihydroxypropoxy)-2,6-dimethylphenyl]acetaldehyde (PubChem CID 87391738) has the molecular formula C13H17BrO4 and a molecular weight of 317.18 g/mol. Its IUPAC name is 2-bromo-2-[4-(2,3-dihydroxypropoxy)-2,6-dimethylphenyl]acetaldehyde.
| Compound Name | 2-bromo-2-[4-(2,3-dihydroxypropoxy)-2,6-dimethylphenyl]acetaldehyde |
|---|---|
| PubChem CID | 87391738 |
| Molecular Formula | C13H17BrO4 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 2-bromo-2-[4-(2,3-dihydroxypropoxy)-2,6-dimethylphenyl]acetaldehyde |
| SMILES | Cc1cc(OCC(O)CO)cc(C)c1C(Br)C=O |
| InChI | InChI=1S/C13H17BrO4/c1-8-3-11(18-7-10(17)5-15)4-9(2)13(8)12(14)6-16/h3-4,6,10,12,15,17H,5,7H2,1-2H3 |
| InChIKey | KXMXNDNJOVHTBF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|