C13H19BrN6O2 — CID 87392572
4-[5-bromo-3-[2-(dimethylamino)ethylideneamino]pyrazin-2-yl]piperazine-1-carboxylic acid (PubChem CID 87392572) has the molecular formula C13H19BrN6O2 and a molecular weight of 371.24 g/mol. Its IUPAC name is 4-[5-bromo-3-[2-(dimethylamino)ethylideneamino]pyrazin-2-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[5-bromo-3-[2-(dimethylamino)ethylideneamino]pyrazin-2-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87392572 |
| Molecular Formula | C13H19BrN6O2 |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-[5-bromo-3-[2-(dimethylamino)ethylideneamino]pyrazin-2-yl]piperazine-1-carboxylic acid |
| SMILES | CN(C)C/C=N/c1nc(Br)cnc1N1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C13H19BrN6O2/c1-18(2)4-3-15-11-12(16-9-10(14)17-11)19-5-7-20(8-6-19)13(21)22/h3,9H,4-8H2,1-2H3,(H,21,22)/b15-3+ |
| InChIKey | SDAMAXKCLCPKCL-CRKCGEKBSA-N |
| XLogP | 1.30 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|