C6H15N3S — CID 87392801
1,1-diethyl-3-(methylamino)thiourea (PubChem CID 87392801) has the molecular formula C6H15N3S and a molecular weight of 161.27 g/mol. Its IUPAC name is 1,1-diethyl-3-(methylamino)thiourea.
| Compound Name | 1,1-diethyl-3-(methylamino)thiourea |
|---|---|
| PubChem CID | 87392801 |
| Molecular Formula | C6H15N3S |
| Molecular Weight | 161.27 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 1,1-diethyl-3-(methylamino)thiourea |
| SMILES | CCN(CC)C(=S)NNC |
| InChI | InChI=1S/C6H15N3S/c1-4-9(5-2)6(10)8-7-3/h7H,4-5H2,1-3H3,(H,8,10) |
| InChIKey | MKOYRCQLHBILTP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|