C17H27N5O6 — CID 87394168
[(carboxyamino)-[[2-methyl-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-3-pyridinyl]amino]methyl]carbamic acid (PubChem CID 87394168) has the molecular formula C17H27N5O6 and a molecular weight of 397.43 g/mol. Its IUPAC name is [(carboxyamino)-[[2-methyl-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-3-pyridinyl]amino]methyl]carbamic acid.
| Compound Name | [(carboxyamino)-[[2-methyl-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-3-pyridinyl]amino]methyl]carbamic acid |
|---|---|
| PubChem CID | 87394168 |
| Molecular Formula | C17H27N5O6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [(carboxyamino)-[[2-methyl-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-3-pyridinyl]amino]methyl]carbamic acid |
| SMILES | Cc1ncc(CCCNC(=O)OC(C)(C)C)cc1NC(NC(=O)O)NC(=O)O |
| InChI | InChI=1S/C17H27N5O6/c1-10-12(20-13(21-14(23)24)22-15(25)26)8-11(9-19-10)6-5-7-18-16(27)28-17(2,3)4/h8-9,13,20-22H,5-7H2,1-4H3,(H,18,27)(H,23,24)(H,25,26) |
| InChIKey | LODLFZIEGHYHLH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 161.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|