C31H39N5O6 — CID 90993374
tert-butyl N-[3-[5-[bis(phenylmethoxycarbonylamino)methylamino]-6-methyl-3-pyridinyl]propyl]carbamate (PubChem CID 90993374) has the molecular formula C31H39N5O6 and a molecular weight of 577.68 g/mol. Its IUPAC name is tert-butyl N-[3-[5-[bis(phenylmethoxycarbonylamino)methylamino]-6-methyl-3-pyridinyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[5-[bis(phenylmethoxycarbonylamino)methylamino]-6-methyl-3-pyridinyl]propyl]carbamate |
|---|---|
| PubChem CID | 90993374 |
| Molecular Formula | C31H39N5O6 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | tert-butyl N-[3-[5-[bis(phenylmethoxycarbonylamino)methylamino]-6-methyl-3-pyridinyl]propyl]carbamate |
| SMILES | Cc1ncc(CCCNC(=O)OC(C)(C)C)cc1NC(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H39N5O6/c1-22-26(18-25(19-33-22)16-11-17-32-28(37)42-31(2,3)4)34-27(35-29(38)40-20-23-12-7-5-8-13-23)36-30(39)41-21-24-14-9-6-10-15-24/h5-10,12-15,18-19,27,34H,11,16-17,20-21H2,1-4H3,(H,32,37)(H,35,38)(H,36,39) |
| InChIKey | GAIHIVJVQYBIGO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 139.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|