About decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate
decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate (PubChem CID 87394598) has the molecular formula C14H27NO3S
and a molecular weight of 289.44 g/mol. Its IUPAC name is decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate.
Molecular Properties
| Compound Name | decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate |
| PubChem CID | 87394598 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate |
| SMILES | CCCCCCCCC(C)OC(=O)C(=S)CCON |
| InChI | InChI=1S/C14H27NO3S/c1-3-4-5-6-7-8-9-12(2)18-14(16)13(19)10-11-17-15/h12H,3-11,15H2,1-2H3 |
| InChIKey | NXBWXEGDXWXCLM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate?
The IUPAC name of decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate (CID 87394598) is decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate.
What is the SMILES notation for decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate?
The canonical SMILES for decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate is CCCCCCCCC(C)OC(=O)C(=S)CCON.
What is the InChIKey of decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate?
The InChIKey is NXBWXEGDXWXCLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3S/c1-3-4-5-6-7-8-9-12(2)18-14(16)13(19)10-11-17-15/h12H,3-11,15H2,1-2H3.
What are the key properties of decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate?
decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate has a molecular weight of 289.44 g/mol, XLogP of 3.32, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for decan-2-yl 4-aminooxy-2-sulfanylidenebutanoate is sourced from PubChem (CID 87394598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).