About N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide
N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide (PubChem CID 87395765) has the molecular formula C19H33NO4
and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide.
Molecular Properties
| Compound Name | N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide |
| PubChem CID | 87395765 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide |
| SMILES | CCCCCCCCCCCCCC(=O)N[C@H]1CCC(=O)OC1=O |
| InChI | InChI=1S/C19H33NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(21)20-16-14-15-18(22)24-19(16)23/h16H,2-15H2,1H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | JKJAGGSSIABANO-INIZCTEOSA-N |
| XLogP | 4.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide?
The IUPAC name of N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide (CID 87395765) is N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide.
What is the SMILES notation for N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide?
The canonical SMILES for N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide is CCCCCCCCCCCCCC(=O)N[C@H]1CCC(=O)OC1=O.
What is the InChIKey of N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide?
The InChIKey is JKJAGGSSIABANO-INIZCTEOSA-N. The full InChI is InChI=1S/C19H33NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(21)20-16-14-15-18(22)24-19(16)23/h16H,2-15H2,1H3,(H,20,21)/t16-/m0/s1.
What are the key properties of N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide?
N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide has a molecular weight of 339.48 g/mol, XLogP of 4.04, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide is sourced from PubChem (CID 87395765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).