C19H33NO4 — CID 87395765
N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide (PubChem CID 87395765) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide.
| Compound Name | N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide |
|---|---|
| PubChem CID | 87395765 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | N-[(3S)-2,6-dioxooxan-3-yl]tetradecanamide |
| SMILES | CCCCCCCCCCCCCC(=O)N[C@H]1CCC(=O)OC1=O |
| InChI | InChI=1S/C19H33NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(21)20-16-14-15-18(22)24-19(16)23/h16H,2-15H2,1H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | JKJAGGSSIABANO-INIZCTEOSA-N |
| XLogP | 4.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|